C12H20N4O3 — CID 12782103
5-nitroso-6-(octylamino)-1H-pyrimidine-2,4-dione (PubChem CID 12782103) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-nitroso-6-(octylamino)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-nitroso-6-(octylamino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12782103 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-nitroso-6-(octylamino)-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCCCCNc1[nH]c(=O)[nH]c(=O)c1N=O |
| InChI | InChI=1S/C12H20N4O3/c1-2-3-4-5-6-7-8-13-10-9(16-19)11(17)15-12(18)14-10/h2-8H2,1H3,(H3,13,14,15,17,18) |
| InChIKey | YDRCUCXLWRJFJU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|