C32H32N2O2 — CID 136715158
2-[[[(1R,2S)-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]amino]methyl]-6-phenylphenol (PubChem CID 136715158) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[[[(1R,2S)-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]amino]methyl]-6-phenylphenol.
| Compound Name | 2-[[[(1R,2S)-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]amino]methyl]-6-phenylphenol |
|---|---|
| PubChem CID | 136715158 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[[[(1R,2S)-2-[(2-hydroxy-3-phenylphenyl)methylideneamino]cyclohexyl]amino]methyl]-6-phenylphenol |
| SMILES | Oc1c(/C=N/[C@H]2CCCC[C@H]2NCc2cccc(-c3ccccc3)c2O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C32H32N2O2/c35-31-25(15-9-17-27(31)23-11-3-1-4-12-23)21-33-29-19-7-8-20-30(29)34-22-26-16-10-18-28(32(26)36)24-13-5-2-6-14-24/h1-6,9-18,21,29-30,34-36H,7-8,19-20,22H2/b33-21+/t29-,30+/m0/s1 |
| InChIKey | RUQNEGRNWKGISC-DPLQEDERSA-N |
| XLogP | 6.95 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|