C50H44N2O4 — CID 135973232
3-[[[(2S)-2-[[3-hydroxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]cyclohexyl]amino]methyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 135973232) has the molecular formula C50H44N2O4 and a molecular weight of 736.91 g/mol. Its IUPAC name is 3-[[[(2S)-2-[[3-hydroxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]cyclohexyl]amino]methyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 3-[[[(2S)-2-[[3-hydroxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]cyclohexyl]amino]methyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135973232 |
| Molecular Formula | C50H44N2O4 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.33 |
| IUPAC Name | 3-[[[(2S)-2-[[3-hydroxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]cyclohexyl]amino]methyl]-1-(2-methoxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | COc1ccc2ccccc2c1-c1c(O)c(/C=N/[C@H]2CCCCC2NCc2cc3ccccc3c(-c3c(OC)ccc4ccccc34)c2O)cc2ccccc12 |
| InChI | InChI=1S/C50H44N2O4/c1-55-43-25-23-31-13-3-7-17-37(31)45(43)47-39-19-9-5-15-33(39)27-35(49(47)53)29-51-41-21-11-12-22-42(41)52-30-36-28-34-16-6-10-20-40(34)48(50(36)54)46-38-18-8-4-14-32(38)24-26-44(46)56-2/h3-10,13-20,23-29,41-42,52-54H,11-12,21-22,30H2,1-2H3/b51-29+/t41-,42?/m0/s1 |
| InChIKey | FGZKEWNIPOBSBK-PBDZOCTPSA-N |
| XLogP | 11.58 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|