C18H18BF4MnN2O2 — CID 11351058
manganese(3+);2-methyl-6-[2-[(3-methyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;tetrafluoroborate (PubChem CID 11351058) has the molecular formula C18H18BF4MnN2O2 and a molecular weight of 436.10 g/mol. Its IUPAC name is manganese(3+);2-methyl-6-[2-[(3-methyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;tetrafluoroborate.
| Compound Name | manganese(3+);2-methyl-6-[2-[(3-methyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;tetrafluoroborate |
|---|---|
| PubChem CID | 11351058 |
| Molecular Formula | C18H18BF4MnN2O2 |
| Molecular Weight | 436.10 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | manganese(3+);2-methyl-6-[2-[(3-methyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;tetrafluoroborate |
| SMILES | Cc1cccc(/C=N/CC/N=C/c2cccc(C)c2[O-])c1[O-].F[B-](F)(F)F.[Mn+3] |
| InChI | InChI=1S/C18H20N2O2.BF4.Mn/c1-13-5-3-7-15(17(13)21)11-19-9-10-20-12-16-8-4-6-14(2)18(16)22;2-1(3,4)5;/h3-8,11-12,21-22H,9-10H2,1-2H3;;/q;-1;+3/p-2/b19-11+,20-12+;; |
| InChIKey | VQYULOLKFCIKOG-GAMUHHASSA-L |
| XLogP | 3.29 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.10 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|