C18H21ClN2Pt — CID 66572690
chloroplatinum(1+);N,N-dimethyl-2-[[2-(4-methylbenzene-6-id-1-yl)phenyl]methylideneamino]ethanamine (PubChem CID 66572690) has the molecular formula C18H21ClN2Pt and a molecular weight of 495.91 g/mol. Its IUPAC name is chloroplatinum(1+);N,N-dimethyl-2-[[2-(4-methylbenzene-6-id-1-yl)phenyl]methylideneamino]ethanamine.
| Compound Name | chloroplatinum(1+);N,N-dimethyl-2-[[2-(4-methylbenzene-6-id-1-yl)phenyl]methylideneamino]ethanamine |
|---|---|
| PubChem CID | 66572690 |
| Molecular Formula | C18H21ClN2Pt |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | chloroplatinum(1+);N,N-dimethyl-2-[[2-(4-methylbenzene-6-id-1-yl)phenyl]methylideneamino]ethanamine |
| SMILES | Cc1c[c-]c(-c2ccccc2/C=N/CCN(C)C)cc1.Cl[Pt+] |
| InChI | InChI=1S/C18H21N2.ClH.Pt/c1-15-8-10-16(11-9-15)18-7-5-4-6-17(18)14-19-12-13-20(2)3;;/h4-10,14H,12-13H2,1-3H3;1H;/q-1;;+2/p-1/b19-14+;; |
| InChIKey | JKLKROUNZBVDDV-ZWXFCGGNSA-M |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|