C11H12Cl4N2 — CID 12048915
N,N-dimethyl-2-[(2,3,4,5-tetrachlorophenyl)methylideneamino]ethanamine (PubChem CID 12048915) has the molecular formula C11H12Cl4N2 and a molecular weight of 314.04 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2,3,4,5-tetrachlorophenyl)methylideneamino]ethanamine.
| Compound Name | N,N-dimethyl-2-[(2,3,4,5-tetrachlorophenyl)methylideneamino]ethanamine |
|---|---|
| PubChem CID | 12048915 |
| Molecular Formula | C11H12Cl4N2 |
| Molecular Weight | 314.04 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | N,N-dimethyl-2-[(2,3,4,5-tetrachlorophenyl)methylideneamino]ethanamine |
| SMILES | CN(C)CC/N=C/c1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl4N2/c1-17(2)4-3-16-6-7-5-8(12)10(14)11(15)9(7)13/h5-6H,3-4H2,1-2H3/b16-6+ |
| InChIKey | BYZCZDBQSMFUAV-OMCISZLKSA-N |
| XLogP | 4.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|