C18H26N4S — CID 110519681
4-[(Z)-(4-tert-butylphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 110519681) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is 4-[(Z)-(4-tert-butylphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(4-tert-butylphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110519681 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-[(Z)-(4-tert-butylphenyl)methylideneamino]-3-pentan-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCC(CC)c1n[nH]c(=S)n1/N=C\c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N4S/c1-6-14(7-2)16-20-21-17(23)22(16)19-12-13-8-10-15(11-9-13)18(3,4)5/h8-12,14H,6-7H2,1-5H3,(H,21,23)/b19-12- |
| InChIKey | XYZDLWQHEKTUJU-UNOMPAQXSA-N |
| XLogP | 5.02 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|