C22H32N4O2+2 — CID 135421377
[3-hydroxy-4-[2-[[2-hydroxy-4-(trimethylazaniumyl)phenyl]methylideneamino]ethyliminomethyl]phenyl]-trimethylazanium (PubChem CID 135421377) has the molecular formula C22H32N4O2+2 and a molecular weight of 384.52 g/mol. Its IUPAC name is [3-hydroxy-4-[2-[[2-hydroxy-4-(trimethylazaniumyl)phenyl]methylideneamino]ethyliminomethyl]phenyl]-trimethylazanium.
| Compound Name | [3-hydroxy-4-[2-[[2-hydroxy-4-(trimethylazaniumyl)phenyl]methylideneamino]ethyliminomethyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 135421377 |
| Molecular Formula | C22H32N4O2+2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | [3-hydroxy-4-[2-[[2-hydroxy-4-(trimethylazaniumyl)phenyl]methylideneamino]ethyliminomethyl]phenyl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1ccc(/C=N/CC/N=C/c2ccc([N+](C)(C)C)cc2O)c(O)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-25(2,3)19-9-7-17(21(27)13-19)15-23-11-12-24-16-18-8-10-20(14-22(18)28)26(4,5)6/h7-10,13-16H,11-12H2,1-6H3/p+2 |
| InChIKey | RVMKPVSKYLKYMQ-UHFFFAOYSA-P |
| XLogP | 3.03 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|