C46H62O12S4 — CID 174338392
5-[2,10-dimethyl-4,8-bis(4-sulfophenyl)undecan-6-yl]-2-[2,6-dimethyl-5-(4-sulfophenyl)heptan-3-yl]benzenesulfonic acid (PubChem CID 174338392) has the molecular formula C46H62O12S4 and a molecular weight of 935.26 g/mol. Its IUPAC name is 5-[2,10-dimethyl-4,8-bis(4-sulfophenyl)undecan-6-yl]-2-[2,6-dimethyl-5-(4-sulfophenyl)heptan-3-yl]benzenesulfonic acid.
| Compound Name | 5-[2,10-dimethyl-4,8-bis(4-sulfophenyl)undecan-6-yl]-2-[2,6-dimethyl-5-(4-sulfophenyl)heptan-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 174338392 |
| Molecular Formula | C46H62O12S4 |
| Molecular Weight | 935.26 g/mol |
| Exact Mass | 934.31 |
| IUPAC Name | 5-[2,10-dimethyl-4,8-bis(4-sulfophenyl)undecan-6-yl]-2-[2,6-dimethyl-5-(4-sulfophenyl)heptan-3-yl]benzenesulfonic acid |
| SMILES | CC(C)CC(CC(CC(CC(C)C)c1ccc(S(=O)(=O)O)cc1)c1ccc(C(CC(c2ccc(S(=O)(=O)O)cc2)C(C)C)C(C)C)c(S(=O)(=O)O)c1)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C46H62O12S4/c1-29(2)23-37(33-9-16-40(17-10-33)59(47,48)49)25-39(26-38(24-30(3)4)34-11-18-41(19-12-34)60(50,51)52)36-15-22-43(46(27-36)62(56,57)58)45(32(7)8)28-44(31(5)6)35-13-20-42(21-14-35)61(53,54)55/h9-22,27,29-32,37-39,44-45H,23-26,28H2,1-8H3,(H,47,48,49)(H,50,51,52)(H,53,54,55)(H,56,57,58) |
| InChIKey | YCAUWHWHNXWJQQ-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.26 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|