C26H46O3S — CID 54370277
2,5-di(decan-2-yl)benzenesulfonic acid (PubChem CID 54370277) has the molecular formula C26H46O3S and a molecular weight of 438.72 g/mol. Its IUPAC name is 2,5-di(decan-2-yl)benzenesulfonic acid.
| Compound Name | 2,5-di(decan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 54370277 |
| Molecular Formula | C26H46O3S |
| Molecular Weight | 438.72 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2,5-di(decan-2-yl)benzenesulfonic acid |
| SMILES | CCCCCCCCC(C)c1ccc(C(C)CCCCCCCC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H46O3S/c1-5-7-9-11-13-15-17-22(3)24-19-20-25(26(21-24)30(27,28)29)23(4)18-16-14-12-10-8-6-2/h19-23H,5-18H2,1-4H3,(H,27,28,29) |
| InChIKey | USSBJPLBGZDHPZ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.72 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|