C23H27KN2O3S — CID 173449408
potassium;4-[bis[4-(dimethylamino)phenyl]methyl]benzenesulfonic acid;hydride (PubChem CID 173449408) has the molecular formula C23H27KN2O3S and a molecular weight of 450.65 g/mol. Its IUPAC name is potassium;4-[bis[4-(dimethylamino)phenyl]methyl]benzenesulfonic acid;hydride.
| Compound Name | potassium;4-[bis[4-(dimethylamino)phenyl]methyl]benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173449408 |
| Molecular Formula | C23H27KN2O3S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | potassium;4-[bis[4-(dimethylamino)phenyl]methyl]benzenesulfonic acid;hydride |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc(S(=O)(=O)O)cc2)cc1.[H-].[K+] |
| InChI | InChI=1S/C23H26N2O3S.K.H/c1-24(2)20-11-5-17(6-12-20)23(18-7-13-21(14-8-18)25(3)4)19-9-15-22(16-10-19)29(26,27)28;;/h5-16,23H,1-4H3,(H,26,27,28);;/q;+1;-1 |
| InChIKey | QLYXTHLICSWKMS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|