C16H16N2O5S — CID 87608037
4-[[2-[4-(dimethylamino)phenyl]-2-oxoacetyl]amino]benzenesulfonic acid (PubChem CID 87608037) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[[2-[4-(dimethylamino)phenyl]-2-oxoacetyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[2-[4-(dimethylamino)phenyl]-2-oxoacetyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 87608037 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[[2-[4-(dimethylamino)phenyl]-2-oxoacetyl]amino]benzenesulfonic acid |
| SMILES | CN(C)c1ccc(C(=O)C(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-18(2)13-7-3-11(4-8-13)15(19)16(20)17-12-5-9-14(10-6-12)24(21,22)23/h3-10H,1-2H3,(H,17,20)(H,21,22,23) |
| InChIKey | ANRJBOHJYUJTPM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|