C50H56N2O6S2 — CID 126748920
5-[4-[2-[4-[3-[bis[4-(diethylamino)phenyl]methyl]-4-methylsulfonylphenoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzenesulfinic acid (PubChem CID 126748920) has the molecular formula C50H56N2O6S2 and a molecular weight of 845.14 g/mol. Its IUPAC name is 5-[4-[2-[4-[3-[bis[4-(diethylamino)phenyl]methyl]-4-methylsulfonylphenoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzenesulfinic acid.
| Compound Name | 5-[4-[2-[4-[3-[bis[4-(diethylamino)phenyl]methyl]-4-methylsulfonylphenoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzenesulfinic acid |
|---|---|
| PubChem CID | 126748920 |
| Molecular Formula | C50H56N2O6S2 |
| Molecular Weight | 845.14 g/mol |
| Exact Mass | 844.36 |
| IUPAC Name | 5-[4-[2-[4-[3-[bis[4-(diethylamino)phenyl]methyl]-4-methylsulfonylphenoxy]phenyl]propan-2-yl]phenoxy]-2-methylbenzenesulfinic acid |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2cc(Oc3ccc(C(C)(C)c4ccc(Oc5ccc(C)c(S(=O)O)c5)cc4)cc3)ccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C50H56N2O6S2/c1-9-51(10-2)40-22-14-36(15-23-40)49(37-16-24-41(25-17-37)52(11-3)12-4)46-33-44(31-32-48(46)60(8,55)56)57-42-27-18-38(19-28-42)50(6,7)39-20-29-43(30-21-39)58-45-26-13-35(5)47(34-45)59(53)54/h13-34,49H,9-12H2,1-8H3,(H,53,54) |
| InChIKey | XTKGTXBJWXUNGH-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.14 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|