About 1-chloropentane;2-methylbenzenesulfonic acid
1-chloropentane;2-methylbenzenesulfonic acid (PubChem CID 174931288) has the molecular formula C12H19ClO3S
and a molecular weight of 278.80 g/mol. Its IUPAC name is 1-chloropentane;2-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 1-chloropentane;2-methylbenzenesulfonic acid |
| PubChem CID | 174931288 |
| Molecular Formula | C12H19ClO3S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-chloropentane;2-methylbenzenesulfonic acid |
| SMILES | CCCCCCl.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8O3S.C5H11Cl/c1-6-4-2-3-5-7(6)11(8,9)10;1-2-3-4-5-6/h2-5H,1H3,(H,8,9,10);2-5H2,1H3 |
| InChIKey | CYZSDDWYNMXYCZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;2-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;2-methylbenzenesulfonic acid?
The IUPAC name of 1-chloropentane;2-methylbenzenesulfonic acid (CID 174931288) is 1-chloropentane;2-methylbenzenesulfonic acid.
What is the SMILES notation for 1-chloropentane;2-methylbenzenesulfonic acid?
The canonical SMILES for 1-chloropentane;2-methylbenzenesulfonic acid is CCCCCCl.Cc1ccccc1S(=O)(=O)O.
What is the InChIKey of 1-chloropentane;2-methylbenzenesulfonic acid?
The InChIKey is CYZSDDWYNMXYCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C5H11Cl/c1-6-4-2-3-5-7(6)11(8,9)10;1-2-3-4-5-6/h2-5H,1H3,(H,8,9,10);2-5H2,1H3.
What are the key properties of 1-chloropentane;2-methylbenzenesulfonic acid?
1-chloropentane;2-methylbenzenesulfonic acid has a molecular weight of 278.80 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;2-methylbenzenesulfonic acid is sourced from PubChem (CID 174931288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).