C27H27N3 — CID 2848664
4-[bis(2-methyl-1H-indol-3-yl)methyl]-N,N-dimethylaniline (PubChem CID 2848664) has the molecular formula C27H27N3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[bis(2-methyl-1H-indol-3-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[bis(2-methyl-1H-indol-3-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2848664 |
| Molecular Formula | C27H27N3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-[bis(2-methyl-1H-indol-3-yl)methyl]-N,N-dimethylaniline |
| SMILES | Cc1[nH]c2ccccc2c1C(c1ccc(N(C)C)cc1)c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H27N3/c1-17-25(21-9-5-7-11-23(21)28-17)27(19-13-15-20(16-14-19)30(3)4)26-18(2)29-24-12-8-6-10-22(24)26/h5-16,27-29H,1-4H3 |
| InChIKey | MXLFNKPVXKBMJF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|