C10H4N2S2 — CID 153465452
2-(1,3-benzodithiol-2-ylidene)-2-isocyanoacetonitrile (PubChem CID 153465452) has the molecular formula C10H4N2S2 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(1,3-benzodithiol-2-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 2-(1,3-benzodithiol-2-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 153465452 |
| Molecular Formula | C10H4N2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 2-(1,3-benzodithiol-2-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1Sc2ccccc2S1 |
| InChI | InChI=1S/C10H4N2S2/c1-12-7(6-11)10-13-8-4-2-3-5-9(8)14-10/h2-5H |
| InChIKey | ZYYQLMDRXZACEL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|