C13H8N2O2S2 — CID 155644180
ethyl (2E)-2-[cyano(isocyano)methylidene]-1,3-benzodithiole-5-carboxylate (PubChem CID 155644180) has the molecular formula C13H8N2O2S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl (2E)-2-[cyano(isocyano)methylidene]-1,3-benzodithiole-5-carboxylate.
| Compound Name | ethyl (2E)-2-[cyano(isocyano)methylidene]-1,3-benzodithiole-5-carboxylate |
|---|---|
| PubChem CID | 155644180 |
| Molecular Formula | C13H8N2O2S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | ethyl (2E)-2-[cyano(isocyano)methylidene]-1,3-benzodithiole-5-carboxylate |
| SMILES | [C-]#[N+]/C(C#N)=C1\Sc2ccc(C(=O)OCC)cc2S1 |
| InChI | InChI=1S/C13H8N2O2S2/c1-3-17-12(16)8-4-5-10-11(6-8)19-13(18-10)9(7-14)15-2/h4-6H,3H2,1H3/b13-9+ |
| InChIKey | WWFABIQYGZMSBF-UKTHLTGXSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|