C22H6N6Se2 — CID 158685609
2-[(17E)-17-[cyano(isocyano)methylidene]-5,18-diselena-7,16-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]propanedinitrile (PubChem CID 158685609) has the molecular formula C22H6N6Se2 and a molecular weight of 512.25 g/mol. Its IUPAC name is 2-[(17E)-17-[cyano(isocyano)methylidene]-5,18-diselena-7,16-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]propanedinitrile.
| Compound Name | 2-[(17E)-17-[cyano(isocyano)methylidene]-5,18-diselena-7,16-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 158685609 |
| Molecular Formula | C22H6N6Se2 |
| Molecular Weight | 512.25 g/mol |
| Exact Mass | 513.90 |
| IUPAC Name | 2-[(17E)-17-[cyano(isocyano)methylidene]-5,18-diselena-7,16-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1\nc2cc3ccc4cc5nc(=C(C#N)C#N)[se]c5cc4c3cc2[se]1 |
| InChI | InChI=1S/C22H6N6Se2/c1-26-18(10-25)22-28-17-5-12-3-2-11-4-16-19(29-21(27-16)13(8-23)9-24)6-14(11)15(12)7-20(17)30-22/h2-7H/b22-18+ |
| InChIKey | XQTZOTHRNOEGMB-RELWKKBWSA-N |
| XLogP | 1.95 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|