C24H6N6S2 — CID 159679323
2-[(15E)-15-[cyano(isocyano)methylidene]-3,16-dithia-5,14-diazahexacyclo[9.9.2.02,6.08,21.013,17.018,22]docosa-1,5,7,9,11,13,17,19,21-nonaen-4-ylidene]propanedinitrile (PubChem CID 159679323) has the molecular formula C24H6N6S2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-[(15E)-15-[cyano(isocyano)methylidene]-3,16-dithia-5,14-diazahexacyclo[9.9.2.02,6.08,21.013,17.018,22]docosa-1,5,7,9,11,13,17,19,21-nonaen-4-ylidene]propanedinitrile.
| Compound Name | 2-[(15E)-15-[cyano(isocyano)methylidene]-3,16-dithia-5,14-diazahexacyclo[9.9.2.02,6.08,21.013,17.018,22]docosa-1,5,7,9,11,13,17,19,21-nonaen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159679323 |
| Molecular Formula | C24H6N6S2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-[(15E)-15-[cyano(isocyano)methylidene]-3,16-dithia-5,14-diazahexacyclo[9.9.2.02,6.08,21.013,17.018,22]docosa-1,5,7,9,11,13,17,19,21-nonaen-4-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1\nc2cc3ccc4cc5nc(=C(C#N)C#N)sc5c5ccc(c2s1)c3c45 |
| InChI | InChI=1S/C24H6N6S2/c1-28-18(10-27)24-30-17-7-12-3-2-11-6-16-21(31-23(29-16)13(8-25)9-26)14-4-5-15(22(17)32-24)20(12)19(11)14/h2-7H/b24-18+ |
| InChIKey | SJQRGHOCRLKIPP-HKOYGPOVSA-N |
| XLogP | 4.55 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|