C22F6N6S2 — CID 160968020
(2Z)-2-[17-(diisocyanomethylidene)-2,9,10,12,14,20-hexafluoro-5,18-dithia-7,16-diazapentacyclo[11.7.0.03,11.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]-2-isocyanoacetonitrile (PubChem CID 160968020) has the molecular formula C22F6N6S2 and a molecular weight of 526.41 g/mol. Its IUPAC name is (2Z)-2-[17-(diisocyanomethylidene)-2,9,10,12,14,20-hexafluoro-5,18-dithia-7,16-diazapentacyclo[11.7.0.03,11.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[17-(diisocyanomethylidene)-2,9,10,12,14,20-hexafluoro-5,18-dithia-7,16-diazapentacyclo[11.7.0.03,11.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 160968020 |
| Molecular Formula | C22F6N6S2 |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | (2Z)-2-[17-(diisocyanomethylidene)-2,9,10,12,14,20-hexafluoro-5,18-dithia-7,16-diazapentacyclo[11.7.0.03,11.04,8.015,19]icosa-1,3,7,9,11,13,15,19-octaen-6-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1nc2c(F)c3c(F)c4c(F)c(F)c5n/c(=C(\C#N)[N+]#[C-])sc5c4c(F)c3c(F)c2s1 |
| InChI | InChI=1S/C22F6N6S2/c1-30-5(4-29)21-33-17-15(28)12(25)8-9(18(17)35-21)11(24)7-6(10(8)23)13(26)16-19(14(7)27)36-22(34-16)20(31-2)32-3/b21-5- |
| InChIKey | RTUKNQRWRSBSTO-SQFVCTCFSA-N |
| XLogP | 5.50 |
| TPSA | 62.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|