C17H10N2 — CID 72576976
2-isocyano-2-(2-methylidene-1H-cyclopenta[b]naphthalen-3-ylidene)acetonitrile (PubChem CID 72576976) has the molecular formula C17H10N2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-isocyano-2-(2-methylidene-1H-cyclopenta[b]naphthalen-3-ylidene)acetonitrile.
| Compound Name | 2-isocyano-2-(2-methylidene-1H-cyclopenta[b]naphthalen-3-ylidene)acetonitrile |
|---|---|
| PubChem CID | 72576976 |
| Molecular Formula | C17H10N2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-isocyano-2-(2-methylidene-1H-cyclopenta[b]naphthalen-3-ylidene)acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C(=C)Cc2cc3ccccc3cc21 |
| InChI | InChI=1S/C17H10N2/c1-11-7-14-8-12-5-3-4-6-13(12)9-15(14)17(11)16(10-18)19-2/h3-6,8-9H,1,7H2 |
| InChIKey | XOMQLRQLFGDNBB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|