C42H22N4O4 — CID 21040498
[3-[(10Z)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carbonyl]oxyphenyl] (10E)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carboxylate (PubChem CID 21040498) has the molecular formula C42H22N4O4 and a molecular weight of 646.66 g/mol. Its IUPAC name is [3-[(10Z)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carbonyl]oxyphenyl] (10E)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carboxylate.
| Compound Name | [3-[(10Z)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carbonyl]oxyphenyl] (10E)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carboxylate |
|---|---|
| PubChem CID | 21040498 |
| Molecular Formula | C42H22N4O4 |
| Molecular Weight | 646.66 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | [3-[(10Z)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carbonyl]oxyphenyl] (10E)-10-[cyano(isocyano)methylidene]-9H-anthracene-1-carboxylate |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2ccccc2Cc2c(C(=O)Oc3cccc(OC(=O)c4cccc5c4Cc4ccccc4/C5=C(/C#N)[N+]#[C-])c3)cccc21 |
| InChI | InChI=1S/C42H22N4O4/c1-45-37(23-43)39-29-14-5-3-10-25(29)20-35-31(39)16-8-18-33(35)41(47)49-27-12-7-13-28(22-27)50-42(48)34-19-9-17-32-36(34)21-26-11-4-6-15-30(26)40(32)38(24-44)46-2/h3-19,22H,20-21H2/b39-37-,40-38+ |
| InChIKey | YXJWTDYWWJMNBN-NGHPONOGSA-N |
| XLogP | 8.34 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.66 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|