C46H22N4O4S3 — CID 21040492
S-[4-[4-[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]sulfanylphenyl]sulfonylphenyl] (9Z)-9-[cyano(isocyano)methylidene]fluorene-4-carbothioate (PubChem CID 21040492) has the molecular formula C46H22N4O4S3 and a molecular weight of 790.91 g/mol. Its IUPAC name is S-[4-[4-[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]sulfanylphenyl]sulfonylphenyl] (9Z)-9-[cyano(isocyano)methylidene]fluorene-4-carbothioate.
| Compound Name | S-[4-[4-[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]sulfanylphenyl]sulfonylphenyl] (9Z)-9-[cyano(isocyano)methylidene]fluorene-4-carbothioate |
|---|---|
| PubChem CID | 21040492 |
| Molecular Formula | C46H22N4O4S3 |
| Molecular Weight | 790.91 g/mol |
| Exact Mass | 790.08 |
| IUPAC Name | S-[4-[4-[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]sulfanylphenyl]sulfonylphenyl] (9Z)-9-[cyano(isocyano)methylidene]fluorene-4-carbothioate |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2ccccc2-c2c(C(=O)Sc3ccc(S(=O)(=O)c4ccc(SC(=O)c5cccc6c5-c5ccccc5/C6=C(/C#N)[N+]#[C-])cc4)cc3)cccc21 |
| InChI | InChI=1S/C46H22N4O4S3/c1-49-39(25-47)43-33-11-5-3-9-31(33)41-35(43)13-7-15-37(41)45(51)55-27-17-21-29(22-18-27)57(53,54)30-23-19-28(20-24-30)56-46(52)38-16-8-14-36-42(38)32-10-4-6-12-34(32)44(36)40(26-48)50-2/h3-24H/b43-39-,44-40+ |
| InChIKey | MDBWLRQKAJXVMN-ZQAWYUPNSA-N |
| XLogP | 10.75 |
| TPSA | 124.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.91 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|