C22H11N5 — CID 20816602
(2E)-2-[(3E)-3-[cyano(isocyano)methylidene]-2-(4-methylphenyl)iminoinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 20816602) has the molecular formula C22H11N5 and a molecular weight of 345.37 g/mol. Its IUPAC name is (2E)-2-[(3E)-3-[cyano(isocyano)methylidene]-2-(4-methylphenyl)iminoinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(3E)-3-[cyano(isocyano)methylidene]-2-(4-methylphenyl)iminoinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 20816602 |
| Molecular Formula | C22H11N5 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2E)-2-[(3E)-3-[cyano(isocyano)methylidene]-2-(4-methylphenyl)iminoinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C(=Nc2ccc(C)cc2)/C(=C(\C#N)[N+]#[C-])c2ccccc21 |
| InChI | InChI=1S/C22H11N5/c1-14-8-10-15(11-9-14)27-22-20(18(12-23)25-2)16-6-4-5-7-17(16)21(22)19(13-24)26-3/h4-11H,1H3/b20-18+,21-19+ |
| InChIKey | FRJDDHMXSKXVOR-FRCMOREXSA-N |
| XLogP | 5.09 |
| TPSA | 68.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|