C43H33N3O4 — CID 161462948
[2-ethyl-4-[2-[(9Z)-9-(1-isocyanoethylidene)fluoren-4-yl]oxy-2-oxoethyl]hex-5-enyl] (9E)-9-[cyano(isocyano)methylidene]fluorene-4-carboxylate (PubChem CID 161462948) has the molecular formula C43H33N3O4 and a molecular weight of 655.75 g/mol. Its IUPAC name is [2-ethyl-4-[2-[(9Z)-9-(1-isocyanoethylidene)fluoren-4-yl]oxy-2-oxoethyl]hex-5-enyl] (9E)-9-[cyano(isocyano)methylidene]fluorene-4-carboxylate.
| Compound Name | [2-ethyl-4-[2-[(9Z)-9-(1-isocyanoethylidene)fluoren-4-yl]oxy-2-oxoethyl]hex-5-enyl] (9E)-9-[cyano(isocyano)methylidene]fluorene-4-carboxylate |
|---|---|
| PubChem CID | 161462948 |
| Molecular Formula | C43H33N3O4 |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | [2-ethyl-4-[2-[(9Z)-9-(1-isocyanoethylidene)fluoren-4-yl]oxy-2-oxoethyl]hex-5-enyl] (9E)-9-[cyano(isocyano)methylidene]fluorene-4-carboxylate |
| SMILES | [C-]#[N+]/C(C)=C1/c2ccccc2-c2c(OC(=O)CC(C=C)CC(CC)COC(=O)c3cccc4c3-c3ccccc3/C4=C(/C#N)[N+]#[C-])cccc21 |
| InChI | InChI=1S/C43H33N3O4/c1-6-27(23-38(47)50-37-21-13-19-33-39(26(3)45-4)29-14-8-11-17-32(29)42(33)37)22-28(7-2)25-49-43(48)35-20-12-18-34-40(35)30-15-9-10-16-31(30)41(34)36(24-44)46-5/h6,8-21,27-28H,1,7,22-23,25H2,2-3H3/b39-26-,41-36+ |
| InChIKey | HOJCESFWAKZFRO-BQZRKJQNSA-N |
| XLogP | 9.92 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|