About [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate
[9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate (PubChem CID 87872247) has the molecular formula C25H24N2O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate.
Molecular Properties
| Compound Name | [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate |
| PubChem CID | 87872247 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate |
| SMILES | CCCCC(CC)CC(=O)Oc1cccc2c1-c1ccccc1C2=C(C#N)C#N |
| InChI | InChI=1S/C25H24N2O2/c1-3-5-9-17(4-2)14-23(28)29-22-13-8-12-21-24(18(15-26)16-27)19-10-6-7-11-20(19)25(21)22/h6-8,10-13,17H,3-5,9,14H2,1-2H3 |
| InChIKey | KWXWTIDELVDOJQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate?
The IUPAC name of [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate (CID 87872247) is [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate.
What is the SMILES notation for [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate?
The canonical SMILES for [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate is CCCCC(CC)CC(=O)Oc1cccc2c1-c1ccccc1C2=C(C#N)C#N.
What is the InChIKey of [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate?
The InChIKey is KWXWTIDELVDOJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O2/c1-3-5-9-17(4-2)14-23(28)29-22-13-8-12-21-24(18(15-26)16-27)19-10-6-7-11-20(19)25(21)22/h6-8,10-13,17H,3-5,9,14H2,1-2H3.
What are the key properties of [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate?
[9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate has a molecular weight of 384.48 g/mol, XLogP of 6.03, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(dicyanomethylidene)fluoren-4-yl] 3-ethylheptanoate is sourced from PubChem (CID 87872247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).