C23H24N2O2 — CID 153378187
2-ethylhexyl (2Z)-2-cyano-2-indeno[2,1-b]pyridin-9-ylideneacetate (PubChem CID 153378187) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-ethylhexyl (2Z)-2-cyano-2-indeno[2,1-b]pyridin-9-ylideneacetate.
| Compound Name | 2-ethylhexyl (2Z)-2-cyano-2-indeno[2,1-b]pyridin-9-ylideneacetate |
|---|---|
| PubChem CID | 153378187 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-ethylhexyl (2Z)-2-cyano-2-indeno[2,1-b]pyridin-9-ylideneacetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C1/c2ccccc2-c2cccnc21 |
| InChI | InChI=1S/C23H24N2O2/c1-3-5-9-16(4-2)15-27-23(26)20(14-24)21-18-11-7-6-10-17(18)19-12-8-13-25-22(19)21/h6-8,10-13,16H,3-5,9,15H2,1-2H3/b21-20- |
| InChIKey | SDPLOMWPCMOIJT-MRCUWXFGSA-N |
| XLogP | 5.15 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|