C48H50N4O7 — CID 158728601
benzo[g]quinoline-5,10-dione;2-ethylhexyl 2-cyanoacetate;2-ethylhexyl (2E)-2-cyano-2-(5-oxobenzo[g]quinolin-10-ylidene)acetate (PubChem CID 158728601) has the molecular formula C48H50N4O7 and a molecular weight of 794.95 g/mol. Its IUPAC name is benzo[g]quinoline-5,10-dione;2-ethylhexyl 2-cyanoacetate;2-ethylhexyl (2E)-2-cyano-2-(5-oxobenzo[g]quinolin-10-ylidene)acetate.
| Compound Name | benzo[g]quinoline-5,10-dione;2-ethylhexyl 2-cyanoacetate;2-ethylhexyl (2E)-2-cyano-2-(5-oxobenzo[g]quinolin-10-ylidene)acetate |
|---|---|
| PubChem CID | 158728601 |
| Molecular Formula | C48H50N4O7 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.37 |
| IUPAC Name | benzo[g]quinoline-5,10-dione;2-ethylhexyl 2-cyanoacetate;2-ethylhexyl (2E)-2-cyano-2-(5-oxobenzo[g]quinolin-10-ylidene)acetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C1\c2ccccc2C(=O)c2cccnc21.CCCCC(CC)COC(=O)CC#N.O=C1c2ccccc2C(=O)c2ncccc21 |
| InChI | InChI=1S/C24H24N2O3.C13H7NO2.C11H19NO2/c1-3-5-9-16(4-2)15-29-24(28)20(14-25)21-17-10-6-7-11-18(17)23(27)19-12-8-13-26-22(19)21;15-12-8-4-1-2-5-9(8)13(16)11-10(12)6-3-7-14-11;1-3-5-6-10(4-2)9-14-11(13)7-8-12/h6-8,10-13,16H,3-5,9,15H2,1-2H3;1-7H;10H,3-7,9H2,1-2H3/b21-20+;; |
| InChIKey | IKUWUBWMTOTWRU-SERMZQFOSA-N |
| XLogP | 9.23 |
| TPSA | 177.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|