C29H36O4 — CID 54150955
2-ethylhexyl 5-(9,10-dioxoanthracen-2-yl)-5-methylhexanoate (PubChem CID 54150955) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is 2-ethylhexyl 5-(9,10-dioxoanthracen-2-yl)-5-methylhexanoate.
| Compound Name | 2-ethylhexyl 5-(9,10-dioxoanthracen-2-yl)-5-methylhexanoate |
|---|---|
| PubChem CID | 54150955 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-ethylhexyl 5-(9,10-dioxoanthracen-2-yl)-5-methylhexanoate |
| SMILES | CCCCC(CC)COC(=O)CCCC(C)(C)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H36O4/c1-5-7-11-20(6-2)19-33-26(30)14-10-17-29(3,4)21-15-16-24-25(18-21)28(32)23-13-9-8-12-22(23)27(24)31/h8-9,12-13,15-16,18,20H,5-7,10-11,14,17,19H2,1-4H3 |
| InChIKey | OHRYFURJBRXYAU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|