C28H34O4 — CID 19854016
butyl 7-(9,10-dioxoanthracen-2-yl)-3,7-dimethyloctanoate (PubChem CID 19854016) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is butyl 7-(9,10-dioxoanthracen-2-yl)-3,7-dimethyloctanoate.
| Compound Name | butyl 7-(9,10-dioxoanthracen-2-yl)-3,7-dimethyloctanoate |
|---|---|
| PubChem CID | 19854016 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | butyl 7-(9,10-dioxoanthracen-2-yl)-3,7-dimethyloctanoate |
| SMILES | CCCCOC(=O)CC(C)CCCC(C)(C)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H34O4/c1-5-6-16-32-25(29)17-19(2)10-9-15-28(3,4)20-13-14-23-24(18-20)27(31)22-12-8-7-11-21(22)26(23)30/h7-8,11-14,18-19H,5-6,9-10,15-17H2,1-4H3 |
| InChIKey | FETAVFBMXOGGAZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|