C31H40O4 — CID 19854084
hexyl 5-(7-tert-butyl-9,10-dioxoanthracen-2-yl)-5-methylhexanoate (PubChem CID 19854084) has the molecular formula C31H40O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is hexyl 5-(7-tert-butyl-9,10-dioxoanthracen-2-yl)-5-methylhexanoate.
| Compound Name | hexyl 5-(7-tert-butyl-9,10-dioxoanthracen-2-yl)-5-methylhexanoate |
|---|---|
| PubChem CID | 19854084 |
| Molecular Formula | C31H40O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | hexyl 5-(7-tert-butyl-9,10-dioxoanthracen-2-yl)-5-methylhexanoate |
| SMILES | CCCCCCOC(=O)CCCC(C)(C)c1ccc2c(c1)C(=O)c1cc(C(C)(C)C)ccc1C2=O |
| InChI | InChI=1S/C31H40O4/c1-7-8-9-10-18-35-27(32)12-11-17-31(5,6)22-14-16-24-26(20-22)29(34)25-19-21(30(2,3)4)13-15-23(25)28(24)33/h13-16,19-20H,7-12,17-18H2,1-6H3 |
| InChIKey | XWPXEAGBMXFILD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|