C25H25NO3 — CID 153378255
2-ethylhexyl (2Z)-2-cyano-2-(9-oxoanthracen-2-ylidene)acetate (PubChem CID 153378255) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-ethylhexyl (2Z)-2-cyano-2-(9-oxoanthracen-2-ylidene)acetate.
| Compound Name | 2-ethylhexyl (2Z)-2-cyano-2-(9-oxoanthracen-2-ylidene)acetate |
|---|---|
| PubChem CID | 153378255 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-ethylhexyl (2Z)-2-cyano-2-(9-oxoanthracen-2-ylidene)acetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=c1/ccc2c(c1)C(=O)c1ccccc1C=2 |
| InChI | InChI=1S/C25H25NO3/c1-3-5-8-17(4-2)16-29-25(28)23(15-26)20-12-11-19-13-18-9-6-7-10-21(18)24(27)22(19)14-20/h6-7,9-14,17H,3-5,8,16H2,1-2H3/b23-20- |
| InChIKey | YCPPGCQXBQSBFA-ATJXCDBQSA-N |
| XLogP | 3.49 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |