C23H38N2O2 — CID 25093733
2-ethylhexyl (2Z)-2-[3-(butan-2-ylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate (PubChem CID 25093733) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 2-ethylhexyl (2Z)-2-[3-(butan-2-ylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate.
| Compound Name | 2-ethylhexyl (2Z)-2-[3-(butan-2-ylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 25093733 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 2-ethylhexyl (2Z)-2-[3-(butan-2-ylamino)-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C1\C=C(NC(C)CC)CC(C)(C)C1 |
| InChI | InChI=1S/C23H38N2O2/c1-7-10-11-18(9-3)16-27-22(26)21(15-24)19-12-20(25-17(4)8-2)14-23(5,6)13-19/h12,17-18,25H,7-11,13-14,16H2,1-6H3/b21-19+ |
| InChIKey | POLCNMZSEUZYGD-XUTLUUPISA-N |
| XLogP | 5.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|