C23H44N2O4Si3 — CID 25259602
ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propylamino]cyclohex-2-en-1-ylidene]acetate (PubChem CID 25259602) has the molecular formula C23H44N2O4Si3 and a molecular weight of 496.87 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propylamino]cyclohex-2-en-1-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propylamino]cyclohex-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 25259602 |
| Molecular Formula | C23H44N2O4Si3 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propylamino]cyclohex-2-en-1-ylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=C1\C=C(NCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C23H44N2O4Si3/c1-11-27-22(26)21(18-24)19-15-20(17-23(2,3)16-19)25-13-12-14-32(10,28-30(4,5)6)29-31(7,8)9/h15,25H,11-14,16-17H2,1-10H3/b21-19+ |
| InChIKey | ASSVCZZPMGZDSJ-XUTLUUPISA-N |
| XLogP | 5.83 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|