C24H40N2O2 — CID 58390591
2-ethylhexyl (2Z)-2-[3-[butan-2-yl(methyl)amino]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate (PubChem CID 58390591) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 2-ethylhexyl (2Z)-2-[3-[butan-2-yl(methyl)amino]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate.
| Compound Name | 2-ethylhexyl (2Z)-2-[3-[butan-2-yl(methyl)amino]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 58390591 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 2-ethylhexyl (2Z)-2-[3-[butan-2-yl(methyl)amino]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C1\C=C(N(C)C(C)CC)CC(C)(C)C1 |
| InChI | InChI=1S/C24H40N2O2/c1-8-11-12-19(10-3)17-28-23(27)22(16-25)20-13-21(15-24(5,6)14-20)26(7)18(4)9-2/h13,18-19H,8-12,14-15,17H2,1-7H3/b22-20+ |
| InChIKey | QTPILIFCKRKQPE-LSDHQDQOSA-N |
| XLogP | 6.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|