C26H42O4 — CID 66809462
bis(2-ethylhexyl) 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylate (PubChem CID 66809462) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is bis(2-ethylhexyl) 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylate.
| Compound Name | bis(2-ethylhexyl) 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66809462 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | bis(2-ethylhexyl) 4-methylcyclohepta-2,4,7-triene-1,2-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)C1=CCC=C(C)C=C1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H42O4/c1-6-10-14-21(8-3)18-29-25(27)23-16-12-13-20(5)17-24(23)26(28)30-19-22(9-4)15-11-7-2/h13,16-17,21-22H,6-12,14-15,18-19H2,1-5H3 |
| InChIKey | BZFAHQSFWFRJEY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |