C24H38O4S — CID 20610367
bis(2-ethylhexyl) 5-sulfanylbenzene-1,3-dicarboxylate (PubChem CID 20610367) has the molecular formula C24H38O4S and a molecular weight of 422.63 g/mol. Its IUPAC name is bis(2-ethylhexyl) 5-sulfanylbenzene-1,3-dicarboxylate.
| Compound Name | bis(2-ethylhexyl) 5-sulfanylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 20610367 |
| Molecular Formula | C24H38O4S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | bis(2-ethylhexyl) 5-sulfanylbenzene-1,3-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc(S)cc(C(=O)OCC(CC)CCCC)c1 |
| InChI | InChI=1S/C24H38O4S/c1-5-9-11-18(7-3)16-27-23(25)20-13-21(15-22(29)14-20)24(26)28-17-19(8-4)12-10-6-2/h13-15,18-19,29H,5-12,16-17H2,1-4H3 |
| InChIKey | JKXXEUMTLSLHJP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|