C40H72O10P2 — CID 87200738
bis[bis(2-ethylhexoxy)phosphoryl] benzene-1,3-dicarboxylate (PubChem CID 87200738) has the molecular formula C40H72O10P2 and a molecular weight of 774.95 g/mol. Its IUPAC name is bis[bis(2-ethylhexoxy)phosphoryl] benzene-1,3-dicarboxylate.
| Compound Name | bis[bis(2-ethylhexoxy)phosphoryl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 87200738 |
| Molecular Formula | C40H72O10P2 |
| Molecular Weight | 774.95 g/mol |
| Exact Mass | 774.46 |
| IUPAC Name | bis[bis(2-ethylhexoxy)phosphoryl] benzene-1,3-dicarboxylate |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)OC(=O)c1cccc(C(=O)OP(=O)(OCC(CC)CCCC)OCC(CC)CCCC)c1 |
| InChI | InChI=1S/C40H72O10P2/c1-9-17-22-33(13-5)29-45-51(43,46-30-34(14-6)23-18-10-2)49-39(41)37-26-21-27-38(28-37)40(42)50-52(44,47-31-35(15-7)24-19-11-3)48-32-36(16-8)25-20-12-4/h21,26-28,33-36H,9-20,22-25,29-32H2,1-8H3 |
| InChIKey | RWFXLQBKJCVTTJ-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.95 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|