C21H34N2O2 — CID 91316179
ethyl 2-cyano-2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]acetate (PubChem CID 91316179) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is ethyl 2-cyano-2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]acetate.
| Compound Name | ethyl 2-cyano-2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]acetate |
|---|---|
| PubChem CID | 91316179 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | ethyl 2-cyano-2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]acetate |
| SMILES | CCCCC(CC)C/N=C1/C=C(C(C#N)C(=O)OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C21H34N2O2/c1-6-9-10-16(7-2)15-23-18-11-17(12-21(4,5)13-18)19(14-22)20(24)25-8-3/h11,16,19H,6-10,12-13,15H2,1-5H3/b23-18- |
| InChIKey | FRGKHFRZLPUICX-NKFKGCMQSA-N |
| XLogP | 5.09 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|