C36H42N2O4 — CID 153378262
2-ethylhexyl (2E)-2-cyano-2-[(5E)-5-[1-cyano-2-(2-ethylhexoxy)-2-oxoethylidene]anthracen-1-ylidene]acetate (PubChem CID 153378262) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is 2-ethylhexyl (2E)-2-cyano-2-[(5E)-5-[1-cyano-2-(2-ethylhexoxy)-2-oxoethylidene]anthracen-1-ylidene]acetate.
| Compound Name | 2-ethylhexyl (2E)-2-cyano-2-[(5E)-5-[1-cyano-2-(2-ethylhexoxy)-2-oxoethylidene]anthracen-1-ylidene]acetate |
|---|---|
| PubChem CID | 153378262 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 2-ethylhexyl (2E)-2-cyano-2-[(5E)-5-[1-cyano-2-(2-ethylhexoxy)-2-oxoethylidene]anthracen-1-ylidene]acetate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=c1\cccc2cc3/c(=C(\C#N)C(=O)OCC(CC)CCCC)cccc3cc12 |
| InChI | InChI=1S/C36H42N2O4/c1-5-9-13-25(7-3)23-41-35(39)33(21-37)29-17-11-15-27-20-32-28(19-31(27)29)16-12-18-30(32)34(22-38)36(40)42-24-26(8-4)14-10-6-2/h11-12,15-20,25-26H,5-10,13-14,23-24H2,1-4H3/b33-29+,34-30+ |
| InChIKey | FTJCRQDPEUEIBJ-BNRZXNFUSA-N |
| XLogP | 6.86 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|