About 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile
2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile (PubChem CID 159865523) has the molecular formula C24H29NO2
and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile.
Molecular Properties
| Compound Name | 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile |
| PubChem CID | 159865523 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile |
| SMILES | C=CC(=O)OCC(CC)CCCC.N#Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C13H9N.C11H20O2/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;1-4-7-8-10(5-2)9-13-11(12)6-3/h1-9H;6,10H,3-5,7-9H2,1-2H3 |
| InChIKey | NRRKQQXINGEKNF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile?
The IUPAC name of 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile (CID 159865523) is 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile.
What is the SMILES notation for 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile?
The canonical SMILES for 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile is C=CC(=O)OCC(CC)CCCC.N#Cc1ccccc1-c1ccccc1.
What is the InChIKey of 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile?
The InChIKey is NRRKQQXINGEKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C11H20O2/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;1-4-7-8-10(5-2)9-13-11(12)6-3/h1-9H;6,10H,3-5,7-9H2,1-2H3.
What are the key properties of 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile?
2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile has a molecular weight of 363.50 g/mol, XLogP of 6.16, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl prop-2-enoate;2-phenylbenzonitrile is sourced from PubChem (CID 159865523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).