C15H8F2N2O — CID 140830387
(2Z)-2-(5,6-difluoro-3-oxo-2-propan-2-ylideneinden-1-ylidene)-2-isocyanoacetonitrile (PubChem CID 140830387) has the molecular formula C15H8F2N2O and a molecular weight of 270.24 g/mol. Its IUPAC name is (2Z)-2-(5,6-difluoro-3-oxo-2-propan-2-ylideneinden-1-ylidene)-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-(5,6-difluoro-3-oxo-2-propan-2-ylideneinden-1-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 140830387 |
| Molecular Formula | C15H8F2N2O |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2Z)-2-(5,6-difluoro-3-oxo-2-propan-2-ylideneinden-1-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(=C(C)C)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H8F2N2O/c1-7(2)13-14(12(6-18)19-3)8-4-10(16)11(17)5-9(8)15(13)20/h4-5H,1-2H3/b14-12- |
| InChIKey | DODFVWAZBAONPD-OWBHPGMISA-N |
| XLogP | 3.65 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|