C13H7FN2OS — CID 166497987
(2E)-2-[(5Z)-5-ethylidene-3-fluoro-1-methyl-4-oxocyclopenta[c]thiophen-6-ylidene]-2-isocyanoacetonitrile (PubChem CID 166497987) has the molecular formula C13H7FN2OS and a molecular weight of 258.28 g/mol. Its IUPAC name is (2E)-2-[(5Z)-5-ethylidene-3-fluoro-1-methyl-4-oxocyclopenta[c]thiophen-6-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(5Z)-5-ethylidene-3-fluoro-1-methyl-4-oxocyclopenta[c]thiophen-6-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 166497987 |
| Molecular Formula | C13H7FN2OS |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (2E)-2-[(5Z)-5-ethylidene-3-fluoro-1-methyl-4-oxocyclopenta[c]thiophen-6-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\C)\C(=O)c2c(F)sc(C)c2\1 |
| InChI | InChI=1S/C13H7FN2OS/c1-4-7-10(8(5-15)16-3)9-6(2)18-13(14)11(9)12(7)17/h4H,1-2H3/b7-4-,10-8+ |
| InChIKey | LUXIOBAREMHSON-WIXOJMCHSA-N |
| XLogP | 3.49 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|