C12H4F2N2OS — CID 163952854
2-[(5E)-5-ethylidene-1,3-difluoro-4-oxocyclopenta[c]thiophen-6-ylidene]propanedinitrile (PubChem CID 163952854) has the molecular formula C12H4F2N2OS and a molecular weight of 262.24 g/mol. Its IUPAC name is 2-[(5E)-5-ethylidene-1,3-difluoro-4-oxocyclopenta[c]thiophen-6-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-5-ethylidene-1,3-difluoro-4-oxocyclopenta[c]thiophen-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 163952854 |
| Molecular Formula | C12H4F2N2OS |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-[(5E)-5-ethylidene-1,3-difluoro-4-oxocyclopenta[c]thiophen-6-ylidene]propanedinitrile |
| SMILES | C/C=C1/C(=O)c2c(F)sc(F)c2C1=C(C#N)C#N |
| InChI | InChI=1S/C12H4F2N2OS/c1-2-6-7(5(3-15)4-16)8-9(10(6)17)12(14)18-11(8)13/h2H,1H3/b6-2+ |
| InChIKey | SAVHXNDHYWXVOV-QHHAFSJGSA-N |
| XLogP | 2.97 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|