C14H7F3N2OS — CID 166498001
(2E)-2-[(5Z)-5-ethylidene-3-methyl-6-oxo-2-(trifluoromethyl)cyclopenta[b]thiophen-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 166498001) has the molecular formula C14H7F3N2OS and a molecular weight of 308.28 g/mol. Its IUPAC name is (2E)-2-[(5Z)-5-ethylidene-3-methyl-6-oxo-2-(trifluoromethyl)cyclopenta[b]thiophen-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(5Z)-5-ethylidene-3-methyl-6-oxo-2-(trifluoromethyl)cyclopenta[b]thiophen-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 166498001 |
| Molecular Formula | C14H7F3N2OS |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | (2E)-2-[(5Z)-5-ethylidene-3-methyl-6-oxo-2-(trifluoromethyl)cyclopenta[b]thiophen-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\C)\C(=O)c2sc(C(F)(F)F)c(C)c2\1 |
| InChI | InChI=1S/C14H7F3N2OS/c1-4-7-10(8(5-18)19-3)9-6(2)13(14(15,16)17)21-12(9)11(7)20/h4H,1-2H3/b7-4-,10-8+ |
| InChIKey | XCEZKQVLXHKWJY-WIXOJMCHSA-N |
| XLogP | 4.37 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|