C15H11F2NO — CID 159721191
(3E)-5,6-difluoro-3-(1-isocyanoethylidene)-2-propan-2-ylideneinden-1-one (PubChem CID 159721191) has the molecular formula C15H11F2NO and a molecular weight of 259.25 g/mol. Its IUPAC name is (3E)-5,6-difluoro-3-(1-isocyanoethylidene)-2-propan-2-ylideneinden-1-one.
| Compound Name | (3E)-5,6-difluoro-3-(1-isocyanoethylidene)-2-propan-2-ylideneinden-1-one |
|---|---|
| PubChem CID | 159721191 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3E)-5,6-difluoro-3-(1-isocyanoethylidene)-2-propan-2-ylideneinden-1-one |
| SMILES | [C-]#[N+]/C(C)=C1/C(=C(C)C)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C15H11F2NO/c1-7(2)13-14(8(3)18-4)9-5-11(16)12(17)6-10(9)15(13)19/h5-6H,1-3H3/b14-8+ |
| InChIKey | JYLFHEUTFQVGAB-RIYZIHGNSA-N |
| XLogP | 4.15 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|