C12H4F2N2O — CID 166511293
3-(diisocyanomethylidene)-5,6-difluoroinden-1-one (PubChem CID 166511293) has the molecular formula C12H4F2N2O and a molecular weight of 230.17 g/mol. Its IUPAC name is 3-(diisocyanomethylidene)-5,6-difluoroinden-1-one.
| Compound Name | 3-(diisocyanomethylidene)-5,6-difluoroinden-1-one |
|---|---|
| PubChem CID | 166511293 |
| Molecular Formula | C12H4F2N2O |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-(diisocyanomethylidene)-5,6-difluoroinden-1-one |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1CC(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C12H4F2N2O/c1-15-12(16-2)8-5-11(17)7-4-10(14)9(13)3-6(7)8/h3-4H,5H2 |
| InChIKey | ZFWPASMFSDTHBM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|