C84H82N4O4S2 — CID 171056168
2-[2,7-bis[5-[4-(3,6-dihexoxycarbazol-9-yl)phenyl]thiophen-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile (PubChem CID 171056168) has the molecular formula C84H82N4O4S2 and a molecular weight of 1275.74 g/mol. Its IUPAC name is 2-[2,7-bis[5-[4-(3,6-dihexoxycarbazol-9-yl)phenyl]thiophen-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2,7-bis[5-[4-(3,6-dihexoxycarbazol-9-yl)phenyl]thiophen-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 171056168 |
| Molecular Formula | C84H82N4O4S2 |
| Molecular Weight | 1275.74 g/mol |
| Exact Mass | 1274.58 |
| IUPAC Name | 2-[2,7-bis[5-[4-(3,6-dihexoxycarbazol-9-yl)phenyl]thiophen-2-yl]fluoren-9-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(-c3ccc(-c4ccc(-n5c6ccc(OCCCCCC)cc6c6cc(OCCCCCC)ccc65)cc4)s3)ccc2-c2ccc(-c3ccc(-c4ccc(-n5c6ccc(OCCCCCC)cc6c6cc(OCCCCCC)ccc65)cc4)s3)cc21 |
| InChI | InChI=1S/C84H82N4O4S2/c1-6-10-14-18-46-89-63-32-38-76-69(52-63)70-53-64(90-47-19-15-11-7-2)33-39-77(70)87(76)61-28-22-57(23-29-61)80-42-44-82(93-80)59-26-36-67-68-37-27-60(51-74(68)84(73(67)50-59)75(56-85)86-5)83-45-43-81(94-83)58-24-30-62(31-25-58)88-78-40-34-65(91-48-20-16-12-8-3)54-71(78)72-55-66(35-41-79(72)88)92-49-21-17-13-9-4/h22-45,50-55H,6-21,46-49H2,1-4H3 |
| InChIKey | FENLBNHUUQWZDF-UHFFFAOYSA-N |
| XLogP | 24.69 |
| TPSA | 74.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.74 |
| LogP ≤ 5 | 24.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|