C30H46N2O3S — CID 67164645
3-[7-[3-(dipropylamino)propoxy]-5-oxodibenzothiophen-2-yl]oxy-N,N-dipropylpropan-1-amine (PubChem CID 67164645) has the molecular formula C30H46N2O3S and a molecular weight of 514.78 g/mol. Its IUPAC name is 3-[7-[3-(dipropylamino)propoxy]-5-oxodibenzothiophen-2-yl]oxy-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[7-[3-(dipropylamino)propoxy]-5-oxodibenzothiophen-2-yl]oxy-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 67164645 |
| Molecular Formula | C30H46N2O3S |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 3-[7-[3-(dipropylamino)propoxy]-5-oxodibenzothiophen-2-yl]oxy-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1ccc2c(c1)-c1ccc(OCCCN(CCC)CCC)cc1S2=O |
| InChI | InChI=1S/C30H46N2O3S/c1-5-15-31(16-6-2)19-9-21-34-25-12-14-29-28(23-25)27-13-11-26(24-30(27)36(29)33)35-22-10-20-32(17-7-3)18-8-4/h11-14,23-24H,5-10,15-22H2,1-4H3 |
| InChIKey | FVVAYNLVMMTAGH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|