C24H30N2O3S — CID 67163008
2,7-bis[3-(azetidin-1-yl)propoxy]dibenzothiophene 5-oxide (PubChem CID 67163008) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is 2,7-bis[3-(azetidin-1-yl)propoxy]dibenzothiophene 5-oxide.
| Compound Name | 2,7-bis[3-(azetidin-1-yl)propoxy]dibenzothiophene 5-oxide |
|---|---|
| PubChem CID | 67163008 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2,7-bis[3-(azetidin-1-yl)propoxy]dibenzothiophene 5-oxide |
| SMILES | O=S1c2ccc(OCCCN3CCC3)cc2-c2ccc(OCCCN3CCC3)cc21 |
| InChI | InChI=1S/C24H30N2O3S/c27-30-23-8-6-19(28-15-3-13-25-9-1-10-25)17-22(23)21-7-5-20(18-24(21)30)29-16-4-14-26-11-2-12-26/h5-8,17-18H,1-4,9-16H2 |
| InChIKey | RWNXLASBZJHPSY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|